C28H32N4O5 — CID 131664705
1,3-dimethyl-5-[[(1R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-5-[(4-prop-2-enoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 131664705) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[(1R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-5-[(4-prop-2-enoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[[(1R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-5-[(4-prop-2-enoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 131664705 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1,3-dimethyl-5-[[(1R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-5-[(4-prop-2-enoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCOc1ccc(CC2(CN3CC4C[C@H](C3)c3cccc(=O)n3C4)C(=O)N(C)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C28H32N4O5/c1-4-12-37-22-10-8-19(9-11-22)14-28(25(34)29(2)27(36)30(3)26(28)35)18-31-15-20-13-21(17-31)23-6-5-7-24(33)32(23)16-20/h4-11,20-21H,1,12-18H2,2-3H3/t20?,21-/m1/s1 |
| InChIKey | NIGRPUQKLBRZCR-BPGUCPLFSA-N |
| XLogP | 2.11 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|