C25H28N5O6- — CID 163134560
5-[[4-[hydroxy(oxido)amino]phenyl]methyl]-1,3-dimethyl-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 163134560) has the molecular formula C25H28N5O6- and a molecular weight of 494.53 g/mol. Its IUPAC name is 5-[[4-[hydroxy(oxido)amino]phenyl]methyl]-1,3-dimethyl-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-[hydroxy(oxido)amino]phenyl]methyl]-1,3-dimethyl-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163134560 |
| Molecular Formula | C25H28N5O6- |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 5-[[4-[hydroxy(oxido)amino]phenyl]methyl]-1,3-dimethyl-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C(Cc2ccc(N([O-])O)cc2)(CN2C[C@@H]3C[C@@H](C2)c2cccc(=O)n2C3)C1=O |
| InChI | InChI=1S/C25H28N5O6/c1-26-22(32)25(23(33)27(2)24(26)34,11-16-6-8-19(9-7-16)30(35)36)15-28-12-17-10-18(14-28)20-4-3-5-21(31)29(20)13-17/h3-9,17-18,35H,10-15H2,1-2H3/q-1/t17-,18-/m0/s1 |
| InChIKey | SDGFVFGLACYXFN-ROUUACIJSA-N |
| XLogP | 1.24 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|