C28H34N4O7 — CID 3381522
1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-5-[(2,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 3381522) has the molecular formula C28H34N4O7 and a molecular weight of 538.60 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-5-[(2,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-5-[(2,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3381522 |
| Molecular Formula | C28H34N4O7 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-5-[(2,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(OC)c(OC)cc1CC1(CN2CC3CC(C2)c2cccc(=O)n2C3)C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C28H34N4O7/c1-29-25(34)28(26(35)30(2)27(29)36,12-18-10-22(38-4)23(39-5)11-21(18)37-3)16-31-13-17-9-19(15-31)20-7-6-8-24(33)32(20)14-17/h6-8,10-11,17,19H,9,12-16H2,1-5H3 |
| InChIKey | ORSPKOGLIZTSTG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 110.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|