C27H31BrN4O5S — CID 3578343
5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methyl]-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 3578343) has the molecular formula C27H31BrN4O5S and a molecular weight of 603.54 g/mol. Its IUPAC name is 5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methyl]-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methyl]-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 3578343 |
| Molecular Formula | C27H31BrN4O5S |
| Molecular Weight | 603.54 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | 5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methyl]-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCOc1cc(CC2(CN3CC4CC(C3)c3cccc(=O)n3C4)C(=O)N(C)C(=S)N(C)C2=O)cc(Br)c1O |
| InChI | InChI=1S/C27H31BrN4O5S/c1-4-37-21-10-16(9-19(28)23(21)34)11-27(24(35)29(2)26(38)30(3)25(27)36)15-31-12-17-8-18(14-31)20-6-5-7-22(33)32(20)13-17/h5-7,9-10,17-18,34H,4,8,11-15H2,1-3H3 |
| InChIKey | YOLQANLNDICHCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|