C16H19N7OS — CID 45206907
5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(thiophen-2-ylmethyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine (PubChem CID 45206907) has the molecular formula C16H19N7OS and a molecular weight of 357.44 g/mol. Its IUPAC name is 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(thiophen-2-ylmethyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine.
| Compound Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(thiophen-2-ylmethyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 45206907 |
| Molecular Formula | C16H19N7OS |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(thiophen-2-ylmethyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
| SMILES | c1csc(CNc2nc3nonc3nc2N2CCN3CCCC3C2)c1 |
| InChI | InChI=1S/C16H19N7OS/c1-3-11-10-23(7-6-22(11)5-1)16-15(17-9-12-4-2-8-25-12)18-13-14(19-16)21-24-20-13/h2,4,8,11H,1,3,5-7,9-10H2,(H,17,18,20) |
| InChIKey | VTNOPBKCMMIJNX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |