C14H17N3S — CID 11379923
7-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]thieno[2,3-c]pyridine (PubChem CID 11379923) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 7-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]thieno[2,3-c]pyridine.
| Compound Name | 7-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 11379923 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 7-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]thieno[2,3-c]pyridine |
| SMILES | c1cc2ccsc2c(N2CCN3CCC[C@H]3C2)n1 |
| InChI | InChI=1S/C14H17N3S/c1-2-12-10-17(8-7-16(12)6-1)14-13-11(3-5-15-14)4-9-18-13/h3-5,9,12H,1-2,6-8,10H2/t12-/m0/s1 |
| InChIKey | JBZYFWGOADKYKO-LBPRGKRZSA-N |
| XLogP | 2.58 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |