C22H22FNO3 — CID 50979562
7-[[(3S,4S)-4-(4-fluorophenyl)-3-hydroxypiperidin-1-yl]methyl]-4-methylchromen-2-one (PubChem CID 50979562) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is 7-[[(3S,4S)-4-(4-fluorophenyl)-3-hydroxypiperidin-1-yl]methyl]-4-methylchromen-2-one.
| Compound Name | 7-[[(3S,4S)-4-(4-fluorophenyl)-3-hydroxypiperidin-1-yl]methyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 50979562 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 7-[[(3S,4S)-4-(4-fluorophenyl)-3-hydroxypiperidin-1-yl]methyl]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(CN3CC[C@@H](c4ccc(F)cc4)[C@H](O)C3)ccc12 |
| InChI | InChI=1S/C22H22FNO3/c1-14-10-22(26)27-21-11-15(2-7-18(14)21)12-24-9-8-19(20(25)13-24)16-3-5-17(23)6-4-16/h2-7,10-11,19-20,25H,8-9,12-13H2,1H3/t19-,20+/m0/s1 |
| InChIKey | ZOYWSUXLGYIQCB-VQTJNVASSA-N |
| XLogP | 3.59 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|