C17H23N3OS — CID 50983196
N-(2,3-dimethylphenyl)-2-[3-(4-methyl-1,3-thiazol-5-yl)propylamino]acetamide (PubChem CID 50983196) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[3-(4-methyl-1,3-thiazol-5-yl)propylamino]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[3-(4-methyl-1,3-thiazol-5-yl)propylamino]acetamide |
|---|---|
| PubChem CID | 50983196 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[3-(4-methyl-1,3-thiazol-5-yl)propylamino]acetamide |
| SMILES | Cc1cccc(NC(=O)CNCCCc2scnc2C)c1C |
| InChI | InChI=1S/C17H23N3OS/c1-12-6-4-7-15(13(12)2)20-17(21)10-18-9-5-8-16-14(3)19-11-22-16/h4,6-7,11,18H,5,8-10H2,1-3H3,(H,20,21) |
| InChIKey | ZALXRWPPPUGFMB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|