About N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride
N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride (PubChem CID 50986718) has the molecular formula C14H20ClN5O
and a molecular weight of 309.80 g/mol. Its IUPAC name is N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride.
Molecular Properties
| Compound Name | N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride |
| PubChem CID | 50986718 |
| Molecular Formula | C14H20ClN5O |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride |
| SMILES | Cc1ccc(C)n1Nc1ccc(N2CCOCC2)nn1.[Cl-].[H+] |
| InChI | InChI=1S/C14H19N5O.ClH/c1-11-3-4-12(2)19(11)17-13-5-6-14(16-15-13)18-7-9-20-10-8-18;/h3-6H,7-10H2,1-2H3,(H,15,17);1H |
| InChIKey | IHQNCEYNGSNDAD-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride?
The IUPAC name of N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride (CID 50986718) is N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride.
What is the SMILES notation for N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride?
The canonical SMILES for N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride is Cc1ccc(C)n1Nc1ccc(N2CCOCC2)nn1.[Cl-].[H+].
What is the InChIKey of N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride?
The InChIKey is IHQNCEYNGSNDAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O.ClH/c1-11-3-4-12(2)19(11)17-13-5-6-14(16-15-13)18-7-9-20-10-8-18;/h3-6H,7-10H2,1-2H3,(H,15,17);1H.
What are the key properties of N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride?
N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride has a molecular weight of 309.80 g/mol, XLogP of -1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylpyrrol-1-yl)-6-morpholin-4-ylpyridazin-3-amine;hydron;chloride is sourced from PubChem (CID 50986718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).