C25H30ClNO — CID 50986800
3-[benzyl(ethyl)amino]-2-methyl-1,1-diphenylpropan-1-ol;hydron;chloride (PubChem CID 50986800) has the molecular formula C25H30ClNO and a molecular weight of 395.97 g/mol. Its IUPAC name is 3-[benzyl(ethyl)amino]-2-methyl-1,1-diphenylpropan-1-ol;hydron;chloride.
| Compound Name | 3-[benzyl(ethyl)amino]-2-methyl-1,1-diphenylpropan-1-ol;hydron;chloride |
|---|---|
| PubChem CID | 50986800 |
| Molecular Formula | C25H30ClNO |
| Molecular Weight | 395.97 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-[benzyl(ethyl)amino]-2-methyl-1,1-diphenylpropan-1-ol;hydron;chloride |
| SMILES | CCN(Cc1ccccc1)CC(C)C(O)(c1ccccc1)c1ccccc1.[Cl-].[H+] |
| InChI | InChI=1S/C25H29NO.ClH/c1-3-26(20-22-13-7-4-8-14-22)19-21(2)25(27,23-15-9-5-10-16-23)24-17-11-6-12-18-24;/h4-18,21,27H,3,19-20H2,1-2H3;1H |
| InChIKey | OWJPVCLIRLCQRH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.97 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |