C20H21Cl2NO4 — CID 5098689
ethyl 2-[3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-2-oxoacetate (PubChem CID 5098689) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is ethyl 2-[3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 5098689 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | ethyl 2-[3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1=C(N2CCOCC2)C(=Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H21Cl2NO4/c1-2-27-20(25)19(24)16-6-4-14(18(16)23-7-9-26-10-8-23)11-13-3-5-15(21)12-17(13)22/h3,5,11-12H,2,4,6-10H2,1H3 |
| InChIKey | AFODGNNZQDBLAZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|