C16H18Cl2N2O5 — CID 67899552
ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(morpholin-4-ylcarbamoyl)prop-2-enoate (PubChem CID 67899552) has the molecular formula C16H18Cl2N2O5 and a molecular weight of 389.24 g/mol. Its IUPAC name is ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(morpholin-4-ylcarbamoyl)prop-2-enoate.
| Compound Name | ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(morpholin-4-ylcarbamoyl)prop-2-enoate |
|---|---|
| PubChem CID | 67899552 |
| Molecular Formula | C16H18Cl2N2O5 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(morpholin-4-ylcarbamoyl)prop-2-enoate |
| SMILES | CCOC(=O)C(C(=O)NN1CCOCC1)=C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O5/c1-2-25-16(23)13(15(22)19-20-5-7-24-8-6-20)14(21)11-4-3-10(17)9-12(11)18/h3-4,9,21H,2,5-8H2,1H3,(H,19,22) |
| InChIKey | ZIKRBFUIGPMVQC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|