C20H24Cl2N4OS — CID 3641057
1-[[3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-ethylthiourea (PubChem CID 3641057) has the molecular formula C20H24Cl2N4OS and a molecular weight of 439.41 g/mol. Its IUPAC name is 1-[[3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[[3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 3641057 |
| Molecular Formula | C20H24Cl2N4OS |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 1-[[3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NN=CC1=C(N2CCOCC2)C(=Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H24Cl2N4OS/c1-2-23-20(28)25-24-13-16-4-3-15(19(16)26-7-9-27-10-8-26)11-14-5-6-17(21)12-18(14)22/h5-6,11-13H,2-4,7-10H2,1H3,(H2,23,25,28) |
| InChIKey | HOTXSAVDMWVHFI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|