C22H30N2O3S2 — CID 50992537
methyl (1S,12R,16S)-15-[2,2-bis(ethylsulfanyl)ethyl]-16-hydroxy-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene-11-carboxylate (PubChem CID 50992537) has the molecular formula C22H30N2O3S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is methyl (1S,12R,16S)-15-[2,2-bis(ethylsulfanyl)ethyl]-16-hydroxy-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene-11-carboxylate.
| Compound Name | methyl (1S,12R,16S)-15-[2,2-bis(ethylsulfanyl)ethyl]-16-hydroxy-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 50992537 |
| Molecular Formula | C22H30N2O3S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | methyl (1S,12R,16S)-15-[2,2-bis(ethylsulfanyl)ethyl]-16-hydroxy-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene-11-carboxylate |
| SMILES | CCSC(CN1CC[C@@H]2C(C(=O)OC)c3[nH]c4ccccc4c3[C@H]1[C@H]2O)SCC |
| InChI | InChI=1S/C22H30N2O3S2/c1-4-28-16(29-5-2)12-24-11-10-14-18(22(26)27-3)19-17(20(24)21(14)25)13-8-6-7-9-15(13)23-19/h6-9,14,16,18,20-21,23,25H,4-5,10-12H2,1-3H3/t14-,18?,20+,21+/m1/s1 |
| InChIKey | BYYDVCAUJVRXFS-BWVNTEAJSA-N |
| XLogP | 3.99 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|