C22H32N2S2 — CID 10644016
(1S,12R,13R)-15-[2,2-bis(ethylsulfanyl)ethyl]-13-ethyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene (PubChem CID 10644016) has the molecular formula C22H32N2S2 and a molecular weight of 388.65 g/mol. Its IUPAC name is (1S,12R,13R)-15-[2,2-bis(ethylsulfanyl)ethyl]-13-ethyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene.
| Compound Name | (1S,12R,13R)-15-[2,2-bis(ethylsulfanyl)ethyl]-13-ethyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 10644016 |
| Molecular Formula | C22H32N2S2 |
| Molecular Weight | 388.65 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (1S,12R,13R)-15-[2,2-bis(ethylsulfanyl)ethyl]-13-ethyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene |
| SMILES | CCSC(CN1C[C@H](CC)[C@H]2Cc3[nH]c4ccccc4c3[C@@H]1C2)SCC |
| InChI | InChI=1S/C22H32N2S2/c1-4-15-13-24(14-21(25-5-2)26-6-3)20-12-16(15)11-19-22(20)17-9-7-8-10-18(17)23-19/h7-10,15-16,20-21,23H,4-6,11-14H2,1-3H3/t15-,16-,20-/m0/s1 |
| InChIKey | XYXQYHHNEYLULV-FTRWYGJKSA-N |
| XLogP | 5.95 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|