C20H24N2O3 — CID 10640901
(1S,12R,13E)-15-(2,2-dimethoxyethyl)-13-ethylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-14-one (PubChem CID 10640901) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (1S,12R,13E)-15-(2,2-dimethoxyethyl)-13-ethylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-14-one.
| Compound Name | (1S,12R,13E)-15-(2,2-dimethoxyethyl)-13-ethylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-14-one |
|---|---|
| PubChem CID | 10640901 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (1S,12R,13E)-15-(2,2-dimethoxyethyl)-13-ethylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-14-one |
| SMILES | C/C=C1/C(=O)N(CC(OC)OC)[C@H]2C[C@@H]1Cc1[nH]c3ccccc3c12 |
| InChI | InChI=1S/C20H24N2O3/c1-4-13-12-9-16-19(14-7-5-6-8-15(14)21-16)17(10-12)22(20(13)23)11-18(24-2)25-3/h4-8,12,17-18,21H,9-11H2,1-3H3/b13-4+/t12-,17-/m0/s1 |
| InChIKey | MLGUMABPPGQQJB-OBCSKYBOSA-N |
| XLogP | 3.18 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|