C17H20N2O — CID 14914547
(1S,11Z,12R)-11-(methoxymethylidene)-15-methyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene (PubChem CID 14914547) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (1S,11Z,12R)-11-(methoxymethylidene)-15-methyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene.
| Compound Name | (1S,11Z,12R)-11-(methoxymethylidene)-15-methyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 14914547 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (1S,11Z,12R)-11-(methoxymethylidene)-15-methyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene |
| SMILES | CO/C=C1\c2[nH]c3ccccc3c2[C@@H]2C[C@H]1CCN2C |
| InChI | InChI=1S/C17H20N2O/c1-19-8-7-11-9-15(19)16-12-5-3-4-6-14(12)18-17(16)13(11)10-20-2/h3-6,10-11,15,18H,7-9H2,1-2H3/b13-10-/t11-,15+/m1/s1 |
| InChIKey | GQRFKUGIVODCPV-KKTVAQFNSA-N |
| XLogP | 3.55 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|