C15H26O4Si — CID 50993172
(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2-prop-2-enylpyran-3-one (PubChem CID 50993172) has the molecular formula C15H26O4Si and a molecular weight of 298.46 g/mol. Its IUPAC name is (2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2-prop-2-enylpyran-3-one.
| Compound Name | (2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2-prop-2-enylpyran-3-one |
|---|---|
| PubChem CID | 50993172 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2-prop-2-enylpyran-3-one |
| SMILES | C=CC[C@@H]1O[C@](O)(CO[Si](C)(C)C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C15H26O4Si/c1-7-8-13-12(16)9-10-15(17,19-13)11-18-20(5,6)14(2,3)4/h7,9-10,13,17H,1,8,11H2,2-6H3/t13-,15-/m0/s1 |
| InChIKey | NVUVOMYCTKMWNI-ZFWWWQNUSA-N |
| XLogP | 2.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|