C27H42N4O — CID 50995217
N-cyclopentyl-1-(1-heptyl-5,6-dimethylbenzimidazol-2-yl)piperidine-4-carboxamide (PubChem CID 50995217) has the molecular formula C27H42N4O and a molecular weight of 438.66 g/mol. Its IUPAC name is N-cyclopentyl-1-(1-heptyl-5,6-dimethylbenzimidazol-2-yl)piperidine-4-carboxamide.
| Compound Name | N-cyclopentyl-1-(1-heptyl-5,6-dimethylbenzimidazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50995217 |
| Molecular Formula | C27H42N4O |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | N-cyclopentyl-1-(1-heptyl-5,6-dimethylbenzimidazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCCCCn1c(N2CCC(C(=O)NC3CCCC3)CC2)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C27H42N4O/c1-4-5-6-7-10-15-31-25-19-21(3)20(2)18-24(25)29-27(31)30-16-13-22(14-17-30)26(32)28-23-11-8-9-12-23/h18-19,22-23H,4-17H2,1-3H3,(H,28,32) |
| InChIKey | LHBXMUPBMHXCOD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|