C24H35ClN4O — CID 50995219
1-(6-chloro-5-methyl-1-pentylbenzimidazol-2-yl)-N-cyclopentylpiperidine-4-carboxamide (PubChem CID 50995219) has the molecular formula C24H35ClN4O and a molecular weight of 431.02 g/mol. Its IUPAC name is 1-(6-chloro-5-methyl-1-pentylbenzimidazol-2-yl)-N-cyclopentylpiperidine-4-carboxamide.
| Compound Name | 1-(6-chloro-5-methyl-1-pentylbenzimidazol-2-yl)-N-cyclopentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 50995219 |
| Molecular Formula | C24H35ClN4O |
| Molecular Weight | 431.02 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1-(6-chloro-5-methyl-1-pentylbenzimidazol-2-yl)-N-cyclopentylpiperidine-4-carboxamide |
| SMILES | CCCCCn1c(N2CCC(C(=O)NC3CCCC3)CC2)nc2cc(C)c(Cl)cc21 |
| InChI | InChI=1S/C24H35ClN4O/c1-3-4-7-12-29-22-16-20(25)17(2)15-21(22)27-24(29)28-13-10-18(11-14-28)23(30)26-19-8-5-6-9-19/h15-16,18-19H,3-14H2,1-2H3,(H,26,30) |
| InChIKey | QRKTXBPABBCUEI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|