C23H34N4O — CID 50996832
N-butyl-1-(1-cyclobutyl-5,6-dimethylbenzimidazol-2-yl)piperidine-4-carboxamide (PubChem CID 50996832) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is N-butyl-1-(1-cyclobutyl-5,6-dimethylbenzimidazol-2-yl)piperidine-4-carboxamide.
| Compound Name | N-butyl-1-(1-cyclobutyl-5,6-dimethylbenzimidazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50996832 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | N-butyl-1-(1-cyclobutyl-5,6-dimethylbenzimidazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2nc3cc(C)c(C)cc3n2C2CCC2)CC1 |
| InChI | InChI=1S/C23H34N4O/c1-4-5-11-24-22(28)18-9-12-26(13-10-18)23-25-20-14-16(2)17(3)15-21(20)27(23)19-7-6-8-19/h14-15,18-19H,4-13H2,1-3H3,(H,24,28) |
| InChIKey | QXTQJGJRDGFIKF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|