C7H13N3O — CID 50998320
2-amino-4-propan-2-yl-4,5-dihydro-1H-pyrimidin-6-one (PubChem CID 50998320) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-amino-4-propan-2-yl-4,5-dihydro-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-propan-2-yl-4,5-dihydro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 50998320 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-amino-4-propan-2-yl-4,5-dihydro-1H-pyrimidin-6-one |
| SMILES | CC(C)C1CC(=O)NC(N)=N1 |
| InChI | InChI=1S/C7H13N3O/c1-4(2)5-3-6(11)10-7(8)9-5/h4-5H,3H2,1-2H3,(H3,8,9,10,11) |
| InChIKey | HZGKZWQCPMEJKU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |