C18H27N3O2 — CID 50998914
tert-butyl N-[(C-benzyl-N-cyclopentylcarbonimidoyl)amino]carbamate (PubChem CID 50998914) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl N-[(C-benzyl-N-cyclopentylcarbonimidoyl)amino]carbamate.
| Compound Name | tert-butyl N-[(C-benzyl-N-cyclopentylcarbonimidoyl)amino]carbamate |
|---|---|
| PubChem CID | 50998914 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | tert-butyl N-[(C-benzyl-N-cyclopentylcarbonimidoyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN/C(Cc1ccccc1)=N\C1CCCC1 |
| InChI | InChI=1S/C18H27N3O2/c1-18(2,3)23-17(22)21-20-16(19-15-11-7-8-12-15)13-14-9-5-4-6-10-14/h4-6,9-10,15H,7-8,11-13H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | FTUYJXGLXGMEGL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|