C26H21ClN2O4 — CID 510066
(3-chlorophenyl) (2R,4S)-2-(imidazol-1-ylmethyl)-2-(4-phenylphenyl)-1,3-dioxolane-4-carboxylate (PubChem CID 510066) has the molecular formula C26H21ClN2O4 and a molecular weight of 460.92 g/mol. Its IUPAC name is (3-chlorophenyl) (2R,4S)-2-(imidazol-1-ylmethyl)-2-(4-phenylphenyl)-1,3-dioxolane-4-carboxylate.
| Compound Name | (3-chlorophenyl) (2R,4S)-2-(imidazol-1-ylmethyl)-2-(4-phenylphenyl)-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 510066 |
| Molecular Formula | C26H21ClN2O4 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (3-chlorophenyl) (2R,4S)-2-(imidazol-1-ylmethyl)-2-(4-phenylphenyl)-1,3-dioxolane-4-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1)[C@@H]1CO[C@](Cn2ccnc2)(c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C26H21ClN2O4/c27-22-7-4-8-23(15-22)32-25(30)24-16-31-26(33-24,17-29-14-13-28-18-29)21-11-9-20(10-12-21)19-5-2-1-3-6-19/h1-15,18,24H,16-17H2/t24-,26-/m0/s1 |
| InChIKey | QQFXKXSRVFMIFG-AHWVRZQESA-N |
| XLogP | 5.08 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|