C33H60N2O10 — CID 51032043
tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]ethoxy]ethyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pent-4-enoate (PubChem CID 51032043) has the molecular formula C33H60N2O10 and a molecular weight of 644.85 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]ethoxy]ethyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pent-4-enoate.
| Compound Name | tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]ethoxy]ethyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 51032043 |
| Molecular Formula | C33H60N2O10 |
| Molecular Weight | 644.85 g/mol |
| Exact Mass | 644.42 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]ethoxy]ethyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pent-4-enoate |
| SMILES | C=CCC(C(=O)OC(C)(C)C)N(CCOCCOCCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H60N2O10/c1-14-15-25(29(39)45-33(11,12)13)35(24-28(38)44-32(8,9)10)17-19-41-21-20-40-18-16-34(22-26(36)42-30(2,3)4)23-27(37)43-31(5,6)7/h14,25H,1,15-24H2,2-13H3 |
| InChIKey | IQJOKXARBZDEKQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|