C24H43NO7 — CID 168800630
tert-butyl 2-[(4,4-dimethyl-2-oxopentyl)-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]amino]acetate (PubChem CID 168800630) has the molecular formula C24H43NO7 and a molecular weight of 457.61 g/mol. Its IUPAC name is tert-butyl 2-[(4,4-dimethyl-2-oxopentyl)-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]amino]acetate.
| Compound Name | tert-butyl 2-[(4,4-dimethyl-2-oxopentyl)-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]amino]acetate |
|---|---|
| PubChem CID | 168800630 |
| Molecular Formula | C24H43NO7 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | tert-butyl 2-[(4,4-dimethyl-2-oxopentyl)-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]amino]acetate |
| SMILES | C#CCOCCOCCOCCOCCN(CC(=O)CC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H43NO7/c1-8-10-28-12-14-30-16-17-31-15-13-29-11-9-25(19-21(26)18-23(2,3)4)20-22(27)32-24(5,6)7/h1H,9-20H2,2-7H3 |
| InChIKey | PJHNSNUZXRBEKP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|