C14H8ClF2N3S — CID 51032090
3-(3-chlorophenyl)-4-(2,5-difluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 51032090) has the molecular formula C14H8ClF2N3S and a molecular weight of 323.76 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-(2,5-difluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(3-chlorophenyl)-4-(2,5-difluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 51032090 |
| Molecular Formula | C14H8ClF2N3S |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3-(3-chlorophenyl)-4-(2,5-difluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1ccc(F)c(-n2c(-c3cccc(Cl)c3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C14H8ClF2N3S/c15-9-3-1-2-8(6-9)13-18-19-14(21)20(13)12-7-10(16)4-5-11(12)17/h1-7H,(H,19,21) |
| InChIKey | POFNEUHKAQIWLB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|