C18H15Cl2NO2 — CID 51032251
6-chloro-4-(2-chlorophenyl)-3-(3-hydroxypropyl)-1H-quinolin-2-one (PubChem CID 51032251) has the molecular formula C18H15Cl2NO2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 6-chloro-4-(2-chlorophenyl)-3-(3-hydroxypropyl)-1H-quinolin-2-one.
| Compound Name | 6-chloro-4-(2-chlorophenyl)-3-(3-hydroxypropyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 51032251 |
| Molecular Formula | C18H15Cl2NO2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 6-chloro-4-(2-chlorophenyl)-3-(3-hydroxypropyl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccc(Cl)cc2c(-c2ccccc2Cl)c1CCCO |
| InChI | InChI=1S/C18H15Cl2NO2/c19-11-7-8-16-14(10-11)17(12-4-1-2-6-15(12)20)13(5-3-9-22)18(23)21-16/h1-2,4,6-8,10,22H,3,5,9H2,(H,21,23) |
| InChIKey | GZHVIPCBXUMDJO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |