C23H18ClNO3S — CID 118677166
6-chloro-3-[(4-methylphenyl)sulfonylmethyl]-4-phenyl-1H-quinolin-2-one (PubChem CID 118677166) has the molecular formula C23H18ClNO3S and a molecular weight of 423.92 g/mol. Its IUPAC name is 6-chloro-3-[(4-methylphenyl)sulfonylmethyl]-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[(4-methylphenyl)sulfonylmethyl]-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118677166 |
| Molecular Formula | C23H18ClNO3S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 6-chloro-3-[(4-methylphenyl)sulfonylmethyl]-4-phenyl-1H-quinolin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)Cc2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H18ClNO3S/c1-15-7-10-18(11-8-15)29(27,28)14-20-22(16-5-3-2-4-6-16)19-13-17(24)9-12-21(19)25-23(20)26/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | LQQYMBWMLSPXQR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |