C21H17ClN4O2 — CID 135440123
N'-[5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-1,2-oxazol-3-yl]-N,N-dimethylmethanimidamide (PubChem CID 135440123) has the molecular formula C21H17ClN4O2 and a molecular weight of 392.85 g/mol. Its IUPAC name is N'-[5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-1,2-oxazol-3-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-1,2-oxazol-3-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 135440123 |
| Molecular Formula | C21H17ClN4O2 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N'-[5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-1,2-oxazol-3-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1cc(-c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)on1 |
| InChI | InChI=1S/C21H17ClN4O2/c1-26(2)12-23-18-11-17(28-25-18)20-19(13-6-4-3-5-7-13)15-10-14(22)8-9-16(15)24-21(20)27/h3-12H,1-2H3,(H,24,27)/b23-12+ |
| InChIKey | MMVVCBOPCMIWFU-FSJBWODESA-N |
| XLogP | 4.72 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|