About 1-(2-nitrophenyl)ethyl hydrogen sulfate
1-(2-nitrophenyl)ethyl hydrogen sulfate (PubChem CID 51034596) has the molecular formula C8H9NO6S
and a molecular weight of 247.23 g/mol. Its IUPAC name is 1-(2-nitrophenyl)ethyl hydrogen sulfate.
Molecular Properties
| Compound Name | 1-(2-nitrophenyl)ethyl hydrogen sulfate |
| PubChem CID | 51034596 |
| Molecular Formula | C8H9NO6S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 1-(2-nitrophenyl)ethyl hydrogen sulfate |
| SMILES | CC(OS(=O)(=O)O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9NO6S/c1-6(15-16(12,13)14)7-4-2-3-5-8(7)9(10)11/h2-6H,1H3,(H,12,13,14) |
| InChIKey | CZYUMQYCQYJCSF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-nitrophenyl)ethyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-nitrophenyl)ethyl hydrogen sulfate?
The IUPAC name of 1-(2-nitrophenyl)ethyl hydrogen sulfate (CID 51034596) is 1-(2-nitrophenyl)ethyl hydrogen sulfate.
What is the SMILES notation for 1-(2-nitrophenyl)ethyl hydrogen sulfate?
The canonical SMILES for 1-(2-nitrophenyl)ethyl hydrogen sulfate is CC(OS(=O)(=O)O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 1-(2-nitrophenyl)ethyl hydrogen sulfate?
The InChIKey is CZYUMQYCQYJCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO6S/c1-6(15-16(12,13)14)7-4-2-3-5-8(7)9(10)11/h2-6H,1H3,(H,12,13,14).
What are the key properties of 1-(2-nitrophenyl)ethyl hydrogen sulfate?
1-(2-nitrophenyl)ethyl hydrogen sulfate has a molecular weight of 247.23 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-nitrophenyl)ethyl hydrogen sulfate is sourced from PubChem (CID 51034596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).