C21H21N3 — CID 5104070
2-[7-[benzyl(methyl)amino]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]propanedinitrile (PubChem CID 5104070) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[7-[benzyl(methyl)amino]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]propanedinitrile.
| Compound Name | 2-[7-[benzyl(methyl)amino]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 5104070 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-[7-[benzyl(methyl)amino]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]propanedinitrile |
| SMILES | CN(Cc1ccccc1)C1=CC2=CC(=C(C#N)C#N)CCC2CC1 |
| InChI | InChI=1S/C21H21N3/c1-24(15-16-5-3-2-4-6-16)21-10-9-17-7-8-18(11-19(17)12-21)20(13-22)14-23/h2-6,11-12,17H,7-10,15H2,1H3 |
| InChIKey | ZLZGIHBGGSMCLX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|