C32H34N4 — CID 21344110
(2E)-2-[7-[(9-hexylcarbazol-3-yl)-methylamino]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]-2-isocyanoacetonitrile (PubChem CID 21344110) has the molecular formula C32H34N4 and a molecular weight of 474.65 g/mol. Its IUPAC name is (2E)-2-[7-[(9-hexylcarbazol-3-yl)-methylamino]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[7-[(9-hexylcarbazol-3-yl)-methylamino]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 21344110 |
| Molecular Formula | C32H34N4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (2E)-2-[7-[(9-hexylcarbazol-3-yl)-methylamino]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C=C2C=C(N(C)c3ccc4c(c3)c3ccccc3n4CCCCCC)CCC2CC1 |
| InChI | InChI=1S/C32H34N4/c1-4-5-6-9-18-36-31-11-8-7-10-28(31)29-21-27(16-17-32(29)36)35(3)26-15-14-23-12-13-24(19-25(23)20-26)30(22-33)34-2/h7-8,10-11,16-17,19-21,23H,4-6,9,12-15,18H2,1,3H3/b30-24+ |
| InChIKey | DUHCOEJBTFUMOV-BGABXYSRSA-N |
| XLogP | 8.52 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|