C17H22N2 — CID 155713102
2-(6-butyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-ylidene)propanedinitrile (PubChem CID 155713102) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-(6-butyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-ylidene)propanedinitrile.
| Compound Name | 2-(6-butyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 155713102 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-(6-butyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-ylidene)propanedinitrile |
| SMILES | CCCCC1CCC2=CC(=C(C#N)C#N)CCC2C1 |
| InChI | InChI=1S/C17H22N2/c1-2-3-4-13-5-6-15-10-16(17(11-18)12-19)8-7-14(15)9-13/h10,13-14H,2-9H2,1H3 |
| InChIKey | BXGQYBZOXWCSKO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|