C27H20Cl2N2 — CID 51041494
2,2-bis(2-chloro-2-naphthalen-2-ylethyl)propanedinitrile (PubChem CID 51041494) has the molecular formula C27H20Cl2N2 and a molecular weight of 443.38 g/mol. Its IUPAC name is 2,2-bis(2-chloro-2-naphthalen-2-ylethyl)propanedinitrile.
| Compound Name | 2,2-bis(2-chloro-2-naphthalen-2-ylethyl)propanedinitrile |
|---|---|
| PubChem CID | 51041494 |
| Molecular Formula | C27H20Cl2N2 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 2,2-bis(2-chloro-2-naphthalen-2-ylethyl)propanedinitrile |
| SMILES | N#CC(C#N)(CC(Cl)c1ccc2ccccc2c1)CC(Cl)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H20Cl2N2/c28-25(23-11-9-19-5-1-3-7-21(19)13-23)15-27(17-30,18-31)16-26(29)24-12-10-20-6-2-4-8-22(20)14-24/h1-14,25-26H,15-16H2 |
| InChIKey | QYILRCFGSPYYCK-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|