C12H22O4 — CID 51042315
(4R,5R)-4-[(1R)-1-(methoxymethoxy)but-3-enyl]-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 51042315) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (4R,5R)-4-[(1R)-1-(methoxymethoxy)but-3-enyl]-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-[(1R)-1-(methoxymethoxy)but-3-enyl]-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 51042315 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (4R,5R)-4-[(1R)-1-(methoxymethoxy)but-3-enyl]-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | C=CC[C@@H](OCOC)[C@@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C12H22O4/c1-6-7-10(14-8-13-5)11-9(2)15-12(3,4)16-11/h6,9-11H,1,7-8H2,2-5H3/t9-,10-,11-/m1/s1 |
| InChIKey | UFIDBSHPMBGVGH-GMTAPVOTSA-N |
| XLogP | 2.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|