C16H20N4O5 — CID 51043020
N'-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide (PubChem CID 51043020) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is N'-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide.
| Compound Name | N'-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51043020 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N'-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide |
| SMILES | CCC(CO)(CO)NC(=O)C(=O)Nc1ccc(-c2nnc(C)o2)cc1 |
| InChI | InChI=1S/C16H20N4O5/c1-3-16(8-21,9-22)18-14(24)13(23)17-12-6-4-11(5-7-12)15-20-19-10(2)25-15/h4-7,21-22H,3,8-9H2,1-2H3,(H,17,23)(H,18,24) |
| InChIKey | JLLAEDXTEYHSSU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|