C20H20N4O4 — CID 124575491
N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide (PubChem CID 124575491) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide.
| Compound Name | N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 124575491 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide |
| SMILES | Cc1nnc(-c2ccc(NC(=O)C(=O)N[C@@H](CO)Cc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C20H20N4O4/c1-13-23-24-20(28-13)15-7-9-16(10-8-15)21-18(26)19(27)22-17(12-25)11-14-5-3-2-4-6-14/h2-10,17,25H,11-12H2,1H3,(H,21,26)(H,22,27)/t17-/m1/s1 |
| InChIKey | LJNTVFOCAYUOFF-QGZVFWFLSA-N |
| XLogP | 1.70 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|