C18H13N3O3S — CID 51044911
methyl 3-[[(E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoyl]amino]thiophene-2-carboxylate (PubChem CID 51044911) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is methyl 3-[[(E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 51044911 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | methyl 3-[[(E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)/C(C#N)=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H13N3O3S/c1-24-18(23)16-15(6-7-25-16)21-17(22)11(9-19)8-12-10-20-14-5-3-2-4-13(12)14/h2-8,10,20H,1H3,(H,21,22)/b11-8+ |
| InChIKey | WSUJSVHMFXTDEW-DHZHZOJOSA-N |
| XLogP | 3.56 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|