About acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide
acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide (PubChem CID 51050604) has the molecular formula C47H44BNP3Rh-
and a molecular weight of 829.52 g/mol. Its IUPAC name is acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide.
Molecular Properties
| Compound Name | acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide |
| PubChem CID | 51050604 |
| Molecular Formula | C47H44BNP3Rh- |
| Molecular Weight | 829.52 g/mol |
| Exact Mass | 829.18 |
| IUPAC Name | acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide |
| SMILES | CC#N.[Rh].c1ccc(P(C[B-](CP(c2ccccc2)c2ccccc2)(CP(c2ccccc2)c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H41BP3.C2H3N.Rh/c1-8-22-39(23-9-1)46(36-47(40-24-10-2-11-25-40)41-26-12-3-13-27-41,37-48(42-28-14-4-15-29-42)43-30-16-5-17-31-43)38-49(44-32-18-6-19-33-44)45-34-20-7-21-35-45;1-2-3;/h1-35H,36-38H2;1H3;/q-1;; |
| InChIKey | GGVUOWJSAVPYKC-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 829.52 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide?
The IUPAC name of acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide (CID 51050604) is acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide.
What is the SMILES notation for acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide?
The canonical SMILES for acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide is CC#N.[Rh].c1ccc(P(C[B-](CP(c2ccccc2)c2ccccc2)(CP(c2ccccc2)c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide?
The InChIKey is GGVUOWJSAVPYKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H41BP3.C2H3N.Rh/c1-8-22-39(23-9-1)46(36-47(40-24-10-2-11-25-40)41-26-12-3-13-27-41,37-48(42-28-14-4-15-29-42)43-30-16-5-17-31-43)38-49(44-32-18-6-19-33-44)45-34-20-7-21-35-45;1-2-3;/h1-35H,36-38H2;1H3;/q-1;;.
What are the key properties of acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide?
acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide has a molecular weight of 829.52 g/mol, XLogP of 8.89, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;rhodium;tris(diphenylphosphanylmethyl)-phenylboranuide is sourced from PubChem (CID 51050604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).