About CID 136690961
CID 136690961 (PubChem CID 136690961) has the molecular formula C27H27P2Si
and a molecular weight of 441.55 g/mol.
Molecular Properties
| Compound Name | CID 136690961 |
| PubChem CID | 136690961 |
| Molecular Formula | C27H27P2Si |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | — |
| SMILES | C[Si](CP(c1ccccc1)c1ccccc1)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27P2Si/c1-30(22-28(24-14-6-2-7-15-24)25-16-8-3-9-17-25)23-29(26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21H,22-23H2,1H3 |
| InChIKey | PIGOBMJGSUNHKS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 136690961 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136690961?
The IUPAC name of CID 136690961 (CID 136690961) is not available.
What is the SMILES notation for CID 136690961?
The canonical SMILES for CID 136690961 is C[Si](CP(c1ccccc1)c1ccccc1)CP(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 136690961?
The InChIKey is PIGOBMJGSUNHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27P2Si/c1-30(22-28(24-14-6-2-7-15-24)25-16-8-3-9-17-25)23-29(26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21H,22-23H2,1H3.
What are the key properties of CID 136690961?
CID 136690961 has a molecular weight of 441.55 g/mol, XLogP of 5.46, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136690961 is sourced from PubChem (CID 136690961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).