C18H25N3O3 — CID 51052780
3-[3-(dimethylamino)propylamino]-4-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 51052780) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propylamino]-4-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-(dimethylamino)propylamino]-4-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 51052780 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3-[3-(dimethylamino)propylamino]-4-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CN(C)CCCNc1c(N[C@@H](CO)Cc2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C18H25N3O3/c1-21(2)10-6-9-19-15-16(18(24)17(15)23)20-14(12-22)11-13-7-4-3-5-8-13/h3-5,7-8,14,19-20,22H,6,9-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | YIMWSJOSUWLYLE-CQSZACIVSA-N |
| XLogP | 0.66 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|