C18H16BrFN4OS — CID 51053912
[1-(4-bromo-2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-thiomorpholin-4-ylmethanone (PubChem CID 51053912) has the molecular formula C18H16BrFN4OS and a molecular weight of 435.32 g/mol. Its IUPAC name is [1-(4-bromo-2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(4-bromo-2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 51053912 |
| Molecular Formula | C18H16BrFN4OS |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | [1-(4-bromo-2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1cnn(-c2ccc(Br)cc2F)c1-n1cccc1)N1CCSCC1 |
| InChI | InChI=1S/C18H16BrFN4OS/c19-13-3-4-16(15(20)11-13)24-17(22-5-1-2-6-22)14(12-21-24)18(25)23-7-9-26-10-8-23/h1-6,11-12H,7-10H2 |
| InChIKey | ZSDKHCLUHGJCTR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |