C12H16BrN3O3S — CID 51065755
4-[(5-bromo-2-propylsulfanylpyrimidine-4-carbonyl)amino]butanoic acid (PubChem CID 51065755) has the molecular formula C12H16BrN3O3S and a molecular weight of 362.25 g/mol. Its IUPAC name is 4-[(5-bromo-2-propylsulfanylpyrimidine-4-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(5-bromo-2-propylsulfanylpyrimidine-4-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 51065755 |
| Molecular Formula | C12H16BrN3O3S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 4-[(5-bromo-2-propylsulfanylpyrimidine-4-carbonyl)amino]butanoic acid |
| SMILES | CCCSc1ncc(Br)c(C(=O)NCCCC(=O)O)n1 |
| InChI | InChI=1S/C12H16BrN3O3S/c1-2-6-20-12-15-7-8(13)10(16-12)11(19)14-5-3-4-9(17)18/h7H,2-6H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | LVACGEYHHYNGHI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|