4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid

C9H12N2O4 — CID 66334475

IUPAC4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid
SMILESCc1cnoc1C(=O)NCCCC(=O)O
InChIInChI=1S/C9H12N2O4/c1-6-5-11-15-8(6)9(14)10-4-2-3-7(12)13/h5H,2-4H2,1H3,(H,10,14)(H,12,13)
InChIKeyFZKPKZBPDOVHJM-UHFFFAOYSA-N
MW212.20 g/mol
LogP0.58
Rot. Bonds5

About 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid

4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid (PubChem CID 66334475) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid.

Molecular Properties

Compound Name4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid
PubChem CID66334475
Molecular FormulaC9H12N2O4
Molecular Weight212.20 g/mol
Exact Mass212.08
IUPAC Name4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid
SMILESCc1cnoc1C(=O)NCCCC(=O)O
InChIInChI=1S/C9H12N2O4/c1-6-5-11-15-8(6)9(14)10-4-2-3-7(12)13/h5H,2-4H2,1H3,(H,10,14)(H,12,13)
InChIKeyFZKPKZBPDOVHJM-UHFFFAOYSA-N
XLogP0.58
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.20
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid?
The IUPAC name of 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid (CID 66334475) is 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid.
What is the SMILES notation for 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid?
The canonical SMILES for 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid is Cc1cnoc1C(=O)NCCCC(=O)O.
What is the InChIKey of 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid?
The InChIKey is FZKPKZBPDOVHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-6-5-11-15-8(6)9(14)10-4-2-3-7(12)13/h5H,2-4H2,1H3,(H,10,14)(H,12,13).
What are the key properties of 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid?
4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid has a molecular weight of 212.20 g/mol, XLogP of 0.58, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]butanoic acid is sourced from PubChem (CID 66334475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).