C9H12N2O4 — CID 110835178
4-[(5-methyl-1,3-oxazole-2-carbonyl)amino]butanoic acid (PubChem CID 110835178) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 4-[(5-methyl-1,3-oxazole-2-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(5-methyl-1,3-oxazole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 110835178 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 4-[(5-methyl-1,3-oxazole-2-carbonyl)amino]butanoic acid |
| SMILES | Cc1cnc(C(=O)NCCCC(=O)O)o1 |
| InChI | InChI=1S/C9H12N2O4/c1-6-5-11-9(15-6)8(14)10-4-2-3-7(12)13/h5H,2-4H2,1H3,(H,10,14)(H,12,13) |
| InChIKey | LFNVJDLRBUIEOL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|