C6H8N2O3 — CID 126994874
N-methoxy-5-methyl-1,3-oxazole-2-carboxamide (PubChem CID 126994874) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is N-methoxy-5-methyl-1,3-oxazole-2-carboxamide.
| Compound Name | N-methoxy-5-methyl-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 126994874 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | N-methoxy-5-methyl-1,3-oxazole-2-carboxamide |
| SMILES | CONC(=O)c1ncc(C)o1 |
| InChI | InChI=1S/C6H8N2O3/c1-4-3-7-6(11-4)5(9)8-10-2/h3H,1-2H3,(H,8,9) |
| InChIKey | WRXPKRGRIQBEDG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|