About methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate
methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate (PubChem CID 66336334) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate.
Analyze methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate?
The IUPAC name of methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate (CID 66336334) is methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate.
What is the SMILES notation for methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate?
The canonical SMILES for methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate is COC(=O)CNC(=O)c1oncc1C.
What is the InChIKey of methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate?
The InChIKey is KYYCQCKYYBJSFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-5-3-10-14-7(5)8(12)9-4-6(11)13-2/h3H,4H2,1-2H3,(H,9,12).
What are the key properties of methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate?
methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate has a molecular weight of 198.18 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]acetate is sourced from PubChem (CID 66336334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).