C11H18N2O2 — CID 115668320
N-(2-ethylbutyl)-4-methyl-1,2-oxazole-5-carboxamide (PubChem CID 115668320) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(2-ethylbutyl)-4-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-ethylbutyl)-4-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 115668320 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-(2-ethylbutyl)-4-methyl-1,2-oxazole-5-carboxamide |
| SMILES | CCC(CC)CNC(=O)c1oncc1C |
| InChI | InChI=1S/C11H18N2O2/c1-4-9(5-2)7-12-11(14)10-8(3)6-13-15-10/h6,9H,4-5,7H2,1-3H3,(H,12,14) |
| InChIKey | YVIZFFNXPRZBSR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |