About 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid
3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid (PubChem CID 66334474) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid.
Analyze 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid (CID 66334474) is 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid is Cc1cnoc1C(=O)NCCC(=O)O.
What is the InChIKey of 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid?
The InChIKey is YVPZCGSLXXCVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-5-4-10-14-7(5)8(13)9-3-2-6(11)12/h4H,2-3H2,1H3,(H,9,13)(H,11,12).
What are the key properties of 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid?
3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid has a molecular weight of 198.18 g/mol, XLogP of 0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1,2-oxazole-5-carbonyl)amino]propanoic acid is sourced from PubChem (CID 66334474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).